ECBD

Log in

« first previous Records from 102059 to 102063 of 102063 next last »

Filters

Set predefined filters set:

	Molecule		EOS	Molecular Weight	Hydrogen Bond Acceptors	Hydrogen Bond Donors	Rotatable Bonds	LogP	Topological Polar Surface Area	FP3 Fingerprint	NHs/OHs	Nitrogens and Oxygens	Aliphatic Carbocycles	Aliphatic Heterocycles	Aliphatic Rings	Aromatic Carbocycles	Aromatic Heterocycles	Aromatic Rings	Heteroatoms	Radical Electrons	Saturated Carbocycles	Saturated Heterocycles	Saturated Rings	Valence Electrons	Rings	Aliphatic Carboxylic Acids	Aliphatic Hydroxyl Groups	Aliphatic Hydroxyl Groups Excluding Tert-OH	Nitrogen Functional Groups Attached to Aromatics	Aromatic Carboxylic Acide	Aromatic Nitrogens	Aromatic Amines	Aromatic Hydroxyl Groups	Carboxylic Acids (COO)	Carboxylic Acids (COO2)	Carbonyl Oxygens	Carbonyl Oxygens, excluding COOH	Thiocarbonyls	C(OH)CCN-Ctert-alkyls/C(OH)CCNcyclics	Imines	Tertiary Amines	Secondary Amines	Primary Amines	Hydroxylamine Groups	XCCNR Groups	Tert-alicyclic Amines (no heteroatoms, not quinine-like bridged N)	H-pyrrole nitrogens	Thiol groups	Aldehydes	Alkyl Carbamates (subject to hydrolysis)	Alkyl Halides	Allylic Oxidation Sites excluding Steroid Dienone	Amides	Amidine Groups	Anilines	Aryl Methyl Sites for Hydroxylation	Azide Groups	Azo Groups	Barbiturate Groups	Benzene Rings	Benzodiazepines with no additional Fused Rings	Bicyclic	Diazo Groups	Dihydropyridines	Epoxide Rings	Esters	Ether Oxygens (including phenoxy)	Furan Rings	Guanidine Groups	Halogens	Hydrazine Groups	Hydrazone Groups	Imidazole Rings	Imide Groups	Isocyanates	Isothiocyanates	Ketones	Ketones excluding diaryl, a,b-unsat. dienones, heteroatom on Calpha	Beta Lactams	Cyclic Esters (Lactones)	Methoxy Groups -OCH3	Morpholine Rings	Nitriles	Nitro Groups	Nitro Benzene Ring Substituents	Non-ortho Nitro Benzene Ring Substituents	Nitroso Groups, excluding NO2	Oxazole Rings	Oxime Groups	Para-hydroxylation Sites	Phenols	Phenolic OH excluding Ortho Intramolecular Hbond substituents	Phosphoric Acid Groups	Phosphoric Ester Groups	Piperdine Rings	Piperzine Rings	Primary Amides	Primary Sulfonamides	Pyridine Rings	Guarternary Nitrogens	Thioethers	Sulfonamides	Sulfone Groups	Terminal Acetylenes	Tetrazole Rings	Thiazole Rings	Thiocyanates	Thiophene Rings	Unbranched Alkanes of at least 4 members (excludes halogenated alkanes)	Urea Groups	BCUT2D - Gasteiger Charge Eigenvalue High	BCUT2D - Gasteiger Charge Eigenvalue Low	BCUT2D - Crippen Lowgp Eigenvalue High	BCUT2D - Crippen Lowgp Eigenvalue Low	BCUT2D - Crippen MR Eigenvalue High	BCUT2D - Crippen MR Eigenvalue Low	BCUT2D - Mass Eigenvalue High	BCUT2D - Mass Eigenvalue Low	Balaban’s J	Bertz CT	Chi 0	Chi 0n	Chi 0v	Chi 1	Chi 1n	Chi 1v	Chi 2n	Chi 2v	Chi 3v	Chi 3v	Chi 4n	Chi 4v	Morgan Fingerprint Density (1)	Morgan Fingerprint Density (2)	Morgan Fingerprint Density (3)	CSP3 Fraction	Hall Kier Alpha	Heavy Atoms	Ipc descriptor	Kappa 1	Kappa 2	Kappa 3	Labute ASA	Max ABS Estate Index	Max ABS Partial Charge	Max Estate Index	Max Partial Charge	Minimal ABS Estate Index	Minimal ABS Partial Charge	Minimal State Index	Minimal Partial Charge	Molar Refractivity	Quantitative Estimation of Drug-likeness (QED)	formula	inchikey	inchi	smiles	description	sdfblock
			EOS102184	86.09	2	0	1	0.16	34.14	0.50	0	2	0	0	0	0	0	0	2	0	0	0	0	34	0	0	0	0	0	0	0	0	0	0	0	2	2	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	2	2	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	1.94	-1.73	1.66	-2.01	6.35	-0.13	16.17	10.33	3.57	71.55	5.15	3.82	3.82	2.64	1.66	1.66	1.11	1.11	0.50	0.50	0.00	0.00	1.00	1.17	1.17	0.50	-0.66	6.00	13.61	5.34	1.70	1.64	36.16	9.79	0.29	9.79	0.19	0.38	0.19	-0.38	-0.29	21.36	0.43	C4H6O2	QSJXEFYPDANLFS-UHFFFAOYSA-N	InChI=1S/C4H6O2/c1-3(5)4(2)6/h1-2H3	CC(=O)C(C)=O	empty	EOS102184 RDKit 3D 6 5 0 0 0 0 0 0 0 0999 V2000 1.4055 -0.2039 1.3322 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7445 -0.1327 -0.0062 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3341 -0.2745 -1.0683 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7445 0.1327 0.0062 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4054 0.2040 -1.3322 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3342 0.2745 1.0683 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 4 6 2 0 M END $$$$	empty	2,3-Butanedione
			EOS101853	95.57	1	0	0	0.60	3.24	1.00	0	1	0	0	0	0	0	0	2	0	0	0	0	34	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	1.58	-1.90	1.47	-1.99	5.85	0.51	35.45	11.01	0.00	11.61	3.58	3.86	4.67	1.73	1.34	1.34	1.34	1.34	0.00	0.00	0.00	0.00	1.00	1.00	1.00	1.00	0.25	5.00	3.25	8.98	4.25	344.25	39.38	2.00	0.31	2.00	-0.01	0.00	0.01	0.00	-0.31	26.86	0.43	C3H10ClN	SZYJELPVAFJOGJ-UHFFFAOYSA-N	InChI=1S/C3H9N.ClH/c1-4(2)3;/h1-3H3;1H	CN(C)C.Cl	empty	EOS101853 RDKit 3D 5 3 0 0 0 0 0 0 0 0999 V2000 -0.6817 -1.1633 -0.1210 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0037 0.0027 0.4046 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.6677 1.1697 -0.1366 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3457 -0.0091 -0.1470 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 M END $$$$	empty	TRIMETHYLAMINE HYDROCHLORIDE
			EOS102045	76.12	2	4	0	-0.81	52.04	0.00	4	2	0	0	0	0	0	0	3	0	0	0	0	24	0	0	0	0	0	0	0	0	0	0	0	0	0	1	0	0	0	0	2	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	1.53	-1.68	1.32	-2.18	7.80	1.65	32.09	11.26	2.80	29.02	3.58	2.06	2.88	1.73	0.78	1.19	0.40	0.87	0.00	0.00	0.00	0.00	1.50	1.50	1.50	0.00	-0.31	4.00	3.25	3.69	1.06	8.37	29.78	4.62	0.38	4.62	0.16	0.00	0.16	0.00	-0.38	20.97	0.37	CH4N2S	UMGDCJDMYOKAJW-UHFFFAOYSA-N	InChI=1S/CH4N2S/c2-1(3)4/h(H4,2,3,4)	NC(N)=S	empty	EOS102045 RDKit 3D 4 3 0 0 0 0 0 0 0 0999 V2000 -0.5641 1.2770 -0.0107 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0456 0.0084 -0.0009 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9833 -0.9909 -0.0190 N 0 0 0 0 0 0 0 0 0 0 0 0 1.5930 -0.2945 0.0306 S 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 2 0 M END $$$$	empty	THIOUREA
			EOS102251	90.15	2	3	0	0.24	49.87	0.50	3	2	0	0	0	0	0	0	3	0	0	0	0	30	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	1	1	0	0	0	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	0	0	1.71	-1.78	1.83	-2.01	8.13	1.51	32.17	11.39	2.85	42.91	4.28	2.99	3.80	2.27	1.15	2.38	0.57	1.42	0.22	0.66	0.00	0.00	2.00	2.20	2.20	0.50	-0.18	5.00	9.65	4.82	2.08	3.82	35.25	6.48	0.38	6.48	0.15	0.17	0.15	0.17	-0.38	25.43	0.33	C2H6N2S	SDDKIZNHOCEXTF-UHFFFAOYSA-N	InChI=1S/C2H6N2S/c1-5-2(3)4/h1H3,(H3,3,4)	CSC(=N)N	empty	EOS102251 RDKit 3D 5 4 0 0 0 0 0 0 0 0999 V2000 1.8054 1.0589 0.2437 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1309 -0.6082 0.1202 S 0 0 0 0 0 0 0 0 0 0 0 0 -0.5822 -0.2511 -0.0763 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3775 -1.2648 -0.1977 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.9766 1.0651 -0.0900 N 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 3 5 1 0 M END $$$$	empty	S-METHYLISOTHIOUREA SULFATE
			EOS101859	109.60	1	0	0	-2.67	0.00	1.00	0	1	0	0	0	0	0	0	2	0	0	0	0	40	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	0	0	0	1.88	-2.14	1.73	-3.00	3.87	-0.85	35.45	10.78	0.00	23.02	4.50	4.83	5.58	2.00	1.79	1.79	2.68	2.68	0.00	0.00	0.00	0.00	0.83	0.83	0.83	1.00	0.25	6.00	3.61	9.54	2.43	718.25	45.96	2.13	1.00	2.13	0.07	0.00	0.07	0.00	-1.00	23.96	0.30	C4H12ClN	OKIZCWYLBDKLSU-UHFFFAOYSA-M	InChI=1S/C4H12N.ClH/c1-5(2,3)4;/h1-4H3;1H/q+1;/p-1	C[N+](C)(C)C.[Cl-]	empty	EOS101859 RDKit 3D 6 4 0 0 0 0 0 0 0 0999 V2000 1.0393 0.2470 -1.0356 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 0.0000 0.0000 N 0 0 0 0 0 4 0 0 0 0 0 0 -0.8792 -1.1181 -0.4366 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6567 -0.3585 1.2860 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8168 1.2296 0.1861 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 Cl 0 0 0 0 0 15 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 2 5 1 0 M CHG 2 2 1 6 -1 M END $$$$	empty	Tetramethylammonium

« first previous Records from 102059 to 102063 of 102063 next last »